CymitQuimica logo

CAS 87540-77-0

:

8-chloro-6-phenyl-3-pyrrolidin-1-yl[1,2,4]triazolo[3,4-a]phthalazine

Description:
8-Chloro-6-phenyl-3-pyrrolidin-1-yl[1,2,4]triazolo[3,4-a]phthalazine is a complex organic compound characterized by its unique structural features, which include a triazole ring fused to a phthalazine moiety. The presence of a chloro substituent and a phenyl group contributes to its chemical reactivity and potential biological activity. The pyrrolidine moiety adds to the compound's structural diversity, potentially influencing its pharmacological properties. This compound may exhibit various interactions due to its multiple functional groups, making it of interest in medicinal chemistry, particularly in the development of pharmaceuticals. Its CAS number, 87540-77-0, allows for easy identification in chemical databases. While specific physical properties such as melting point, solubility, and spectral data are not provided here, compounds of this nature typically require careful handling and characterization due to their potential biological effects and reactivity. Further studies would be necessary to elucidate its full range of properties and applications in research or therapeutic contexts.
Formula:C19H16ClN5
InChI:InChI=1/C19H16ClN5/c20-14-8-9-15-16(12-14)17(13-6-2-1-3-7-13)23-25-18(15)21-22-19(25)24-10-4-5-11-24/h1-3,6-9,12H,4-5,10-11H2
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.