CAS 87540-80-5
:8-chloro-3-(1-methylethyl)-6-phenyl[1,2,4]triazolo[3,4-a]phthalazine
Description:
8-Chloro-3-(1-methylethyl)-6-phenyl[1,2,4]triazolo[3,4-a]phthalazine is a chemical compound characterized by its complex structure, which includes a triazole ring fused to a phthalazine moiety. The presence of a chlorine atom at the 8-position and an isopropyl group at the 3-position contributes to its unique reactivity and potential biological activity. This compound is typically classified as a heterocyclic aromatic compound, which may exhibit properties such as fluorescence or specific interactions with biological targets. Its molecular structure suggests potential applications in medicinal chemistry, particularly in the development of pharmaceuticals, due to the presence of the triazole and phthalazine frameworks, which are known for their diverse biological activities. Additionally, the compound's solubility, stability, and reactivity can be influenced by the substituents on the aromatic rings and the triazole, making it a subject of interest for further research in drug development and material science.
Formula:C18H15ClN4
InChI:InChI=1/C18H15ClN4/c1-11(2)17-20-21-18-14-9-8-13(19)10-15(14)16(22-23(17)18)12-6-4-3-5-7-12/h3-11H,1-2H3
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
8-CHLORO-3-(ISOPROPYL)-6-PHENYL-1,2,4-TRIAZOLO[3,4-A]PHTHALAZINE
CAS:Formula:C18H15ClN4Molecular weight:322.7915
