CAS 87540-81-6
:8-chloro-3-(3-chlorophenyl)-6-phenyl[1,2,4]triazolo[3,4-a]phthalazine
Description:
8-Chloro-3-(3-chlorophenyl)-6-phenyl[1,2,4]triazolo[3,4-a]phthalazine is a complex organic compound characterized by its unique triazole and phthalazine structures. This substance features a triazole ring fused to a phthalazine moiety, which contributes to its potential biological activity. The presence of chlorine substituents enhances its lipophilicity and may influence its interaction with biological targets. Typically, compounds of this nature are investigated for their pharmacological properties, including potential anti-cancer or anti-inflammatory activities. The molecular structure suggests that it may exhibit significant electronic properties due to the conjugated systems present, which can affect its reactivity and stability. Additionally, the compound's solubility, melting point, and other physical properties would depend on its specific molecular interactions and the presence of functional groups. As with many synthetic organic compounds, safety and handling precautions are essential, given the potential toxicity associated with halogenated compounds. Further studies would be necessary to fully elucidate its chemical behavior and potential applications in medicinal chemistry.
Formula:C21H12Cl2N4
InChI:InChI=1/C21H12Cl2N4/c22-15-8-4-7-14(11-15)20-24-25-21-17-10-9-16(23)12-18(17)19(26-27(20)21)13-5-2-1-3-6-13/h1-12H
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
8-CHLORO-3-(3-CHLOROPHENYL)-6-PHENYL-1,2,4-TRIAZOLO[3,4-A]PHTHALAZINE
CAS:Formula:C21H12Cl2N4Molecular weight:391.2528
