CymitQuimica logo

CAS 87540-84-9

:

3-(methylsulfanyl)-6-phenyl[1,2,4]triazolo[3,4-a]phthalazine

Description:
3-(Methylsulfanyl)-6-phenyl[1,2,4]triazolo[3,4-a]phthalazine is a chemical compound characterized by its complex structure, which includes a triazole ring fused to a phthalazine moiety. This compound features a methylsulfanyl group, which contributes to its unique chemical properties, including potential reactivity and solubility characteristics. The presence of the phenyl group enhances its aromaticity and may influence its interactions with biological targets, making it of interest in medicinal chemistry. The compound's structure suggests potential applications in pharmaceuticals, particularly in the development of agents with specific biological activities. Its CAS number, 87540-84-9, allows for easy identification and reference in chemical databases. As with many heterocyclic compounds, the specific arrangement of atoms and functional groups can lead to diverse chemical behavior, including potential for forming various derivatives. Overall, this compound exemplifies the intricate relationship between molecular structure and chemical properties, which is fundamental in the field of organic chemistry and drug design.
Formula:C16H12N4S
InChI:InChI=1/C16H12N4S/c1-21-16-18-17-15-13-10-6-5-9-12(13)14(19-20(15)16)11-7-3-2-4-8-11/h2-10H,1H3
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.