CymitQuimica logo

CAS 87540-94-1

:

3-(4-methoxyphenyl)[1,2,4]triazolo[3,4-a]phthalazin-6(5H)-one

Description:
3-(4-Methoxyphenyl)[1,2,4]triazolo[3,4-a]phthalazin-6(5H)-one is a heterocyclic compound characterized by its complex structure, which includes a triazole ring fused to a phthalazine moiety. This compound features a methoxy group attached to a phenyl ring, contributing to its potential biological activity and solubility properties. The presence of the triazole and phthalazine rings suggests that it may exhibit interesting pharmacological properties, including potential anti-inflammatory, antimicrobial, or anticancer activities. The molecular structure allows for various interactions with biological targets, making it a subject of interest in medicinal chemistry. Additionally, the compound's stability and reactivity can be influenced by the substituents on the aromatic rings, which may affect its synthesis and application in drug development. Overall, 3-(4-methoxyphenyl)[1,2,4]triazolo[3,4-a]phthalazin-6(5H)-one represents a unique scaffold for further exploration in pharmaceutical research.
Formula:C16H12N4O2
InChI:InChI=1/C16H12N4O2/c1-22-11-8-6-10(7-9-11)14-17-18-15-12-4-2-3-5-13(12)16(21)19-20(14)15/h2-9H,1H3,(H,19,21)
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.