CAS 87543-80-4
:Ethyl 2-isocyanato-3-phenylpropionate
Description:
Ethyl 2-isocyanato-3-phenylpropionate, with the CAS number 87543-80-4, is an organic compound characterized by its isocyanate functional group, which is known for its reactivity and ability to form ureas and other derivatives. This compound features an ethyl ester moiety and a phenyl group, contributing to its structural complexity and potential applications in organic synthesis. Typically, isocyanates are recognized for their use in the production of polyurethanes and other polymers, as well as in the synthesis of various pharmaceuticals and agrochemicals. Ethyl 2-isocyanato-3-phenylpropionate may exhibit moderate to high toxicity, necessitating careful handling and appropriate safety measures during use. Its reactivity can lead to the formation of stable adducts with nucleophiles, making it a valuable intermediate in chemical reactions. Additionally, the presence of the phenyl group may impart specific physical properties, such as solubility and volatility, influencing its behavior in different chemical environments. Overall, this compound serves as an important building block in synthetic organic chemistry.
Formula:C12H13NO3
InChI:InChI=1/C12H13NO3/c1-2-16-12(15)11(13-9-14)8-10-6-4-3-5-7-10/h3-7,11H,2,8H2,1H3
SMILES:CCOC(=O)C(Cc1ccccc1)N=C=O
Synonyms:- 2-Isocyanato-3-phenylpropionic acid ethyl ester
- ethyl N-(oxomethylidene)phenylalaninate
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
