CAS 875430-26-5
:(3R,6R)-3,4,5-trihydroxy-6-[2-[(4-methoxyphenoxy)carbonyl-[[4-[2-(5-methyl-2-phenyl-oxazol-4-yl)ethoxy]phenyl]methyl]amino]acetyl]oxy-tetrahydropyran-2-carboxylic acid
Description:
The chemical substance with the name "(3R,6R)-3,4,5-trihydroxy-6-[2-[(4-methoxyphenoxy)carbonyl-[[4-[2-(5-methyl-2-phenyl-oxazol-4-yl)ethoxy]phenyl]methyl]amino]acetyl]oxy-tetrahydropyran-2-carboxylic acid" and CAS number "875430-26-5" is a complex organic compound characterized by multiple functional groups, including hydroxyl (-OH), carbonyl (C=O), and ether (R-O-R') groups. Its structure features a tetrahydropyran ring, which contributes to its cyclic nature and potential for stereochemistry, indicated by the (3R,6R) configuration. The presence of methoxy and phenyl groups suggests potential aromatic interactions, while the oxazole moiety may impart unique electronic properties. This compound likely exhibits solubility in polar solvents due to its hydroxyl groups and may participate in hydrogen bonding. Its intricate structure suggests potential biological activity, possibly as a pharmaceutical agent, although specific biological properties would require further investigation. Overall, this compound exemplifies the complexity often found in synthetic organic chemistry, with implications for medicinal chemistry and drug design.
Formula:C35H36N2O13
InChI:InChI=1/C35H36N2O13/c1-20-26(36-32(47-20)22-6-4-3-5-7-22)16-17-46-24-10-8-21(9-11-24)18-37(35(44)48-25-14-12-23(45-2)13-15-25)19-27(38)49-34-30(41)28(39)29(40)31(50-34)33(42)43/h3-15,28-31,34,39-41H,16-19H2,1-2H3,(H,42,43)/t28?,29-,30?,31?,34+/m1/s1
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 4 products.
Muraglitazar acyl-b-D-glucuronide
CAS:<p>Muraglitazar acyl-b-D-glucuronide is a complex carbohydrate that has been modified with fluorination. The compound is synthesized from methylation, glycosylation, and carbamylation reactions with saccharides. The saccharide modification includes the attachment of various sugars such as glucose, galactose, and mannose. Muraglitazar acyl-b-D-glucuronide can be used in the synthesis of oligosaccharides and polysaccharides. It is also used for Click modification of sugar molecules.</p>Formula:C36H38N2O12Purity:Min. 95%Molecular weight:690.71 g/molMuraglitazar glucuronide
CAS:Muraglitazar glucuronide is a Peroxime Proliferator Activated (PPAR) Agonist that has glucose- and lipid-lowering activities.Formula:C35H36N2O13Color and Shape:SolidMolecular weight:692.67



