CymitQuimica logo

CAS 875433-11-7

:

1-(4-bromophenyl)-3-(4-fluorophenyl)propan-1-one

Description:
1-(4-bromophenyl)-3-(4-fluorophenyl)propan-1-one, with the CAS number 875433-11-7, is an organic compound characterized by its ketone functional group and the presence of both bromine and fluorine substituents on the aromatic rings. This compound features a propanone backbone, which contributes to its reactivity and potential applications in organic synthesis. The bromine and fluorine atoms introduce significant electronegative characteristics, influencing the compound's polarity, solubility, and reactivity. Typically, such compounds may exhibit interesting biological activities, making them of interest in medicinal chemistry. The presence of halogens can also affect the compound's stability and interaction with other chemical species. Additionally, the molecular structure suggests potential for various synthetic transformations, including nucleophilic substitutions and coupling reactions. Overall, 1-(4-bromophenyl)-3-(4-fluorophenyl)propan-1-one is a versatile compound with properties that can be tailored for specific applications in research and industry.
Formula:C15H12BrFO
InChI:InChI=1/C15H12BrFO/c16-13-6-4-12(5-7-13)15(18)10-3-11-1-8-14(17)9-2-11/h1-2,4-9H,3,10H2
SMILES:c1cc(ccc1CCC(=O)c1ccc(cc1)Br)F
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.