CAS 87544-56-7
:N-{[1-(2,6-dimethylphenyl)-3-(phenylcarbonyl)-2-thioxo-2,3-dihydro-1H-imidazol-4-yl]carbamothioyl}benzamide
Description:
N-{[1-(2,6-dimethylphenyl)-3-(phenylcarbonyl)-2-thioxo-2,3-dihydro-1H-imidazol-4-yl]carbamothioyl}benzamide, with CAS number 87544-56-7, is a synthetic organic compound characterized by its complex structure, which includes an imidazole ring, thioamide, and aromatic groups. This compound typically exhibits properties associated with thioxo and thioamide functionalities, such as potential reactivity towards electrophiles and nucleophiles. The presence of multiple aromatic rings suggests that it may possess significant stability and lipophilicity, which could influence its solubility in organic solvents. Additionally, the compound may exhibit biological activity, making it of interest in medicinal chemistry and drug development. Its specific interactions and reactivity can be influenced by the substituents on the aromatic rings and the imidazole moiety, which may also affect its pharmacokinetic properties. Overall, this compound represents a class of thioamide derivatives that could have applications in various fields, including pharmaceuticals and agrochemicals.
Formula:C26H22N4O2S2
InChI:InChI=1/C26H22N4O2S2/c1-17-10-9-11-18(2)22(17)29-16-21(27-25(33)28-23(31)19-12-5-3-6-13-19)30(26(29)34)24(32)20-14-7-4-8-15-20/h3-16H,1-2H3,(H2,27,28,31,33)
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
N-[[3-BENZOYL-1-(2,6-DIMETHYLPHENYL)-2-SULFANYLIDENE-IMIDAZOL-4-YL]THIOCARBAMOYL]BENZAMIDE
CAS:Formula:C26H22N4O2S2Molecular weight:486.6085
