CymitQuimica logo

CAS 87544-89-6

:

2-(2-hydroxyethyl)-1H-pyrrolo[3,4-c]pyridine-1,3(2H)-dione

Description:
2-(2-Hydroxyethyl)-1H-pyrrolo[3,4-c]pyridine-1,3(2H)-dione, with the CAS number 87544-89-6, is a chemical compound characterized by its unique bicyclic structure that incorporates both pyrrole and pyridine moieties. This compound features a hydroxyl group and an ethyl group, contributing to its solubility and reactivity. It is typically a solid at room temperature and may exhibit moderate stability under standard conditions. The presence of the dione functional groups suggests potential for hydrogen bonding and reactivity in various chemical environments, making it of interest in medicinal chemistry and organic synthesis. Its structural features may impart biological activity, which could be explored in pharmacological studies. Additionally, the compound's properties, such as melting point, boiling point, and solubility, would depend on the specific conditions and purity of the sample. Overall, 2-(2-hydroxyethyl)-1H-pyrrolo[3,4-c]pyridine-1,3(2H)-dione represents a versatile scaffold for further chemical exploration and potential applications in drug development.
Formula:C9H8N2O3
InChI:InChI=1/C9H8N2O3/c12-4-3-11-8(13)6-1-2-10-5-7(6)9(11)14/h1-2,5,12H,3-4H2
SMILES:c1cncc2c1C(=O)N(CCO)C2=O
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.