CymitQuimica logo

CAS 87545-58-2

:

3-[3-(imidazo[2,1-b][1,3]benzothiazol-2-yl)phenoxy]-3-oxopropanoic acid

Description:
3-[3-(Imidazo[2,1-b][1,3]benzothiazol-2-yl)phenoxy]-3-oxopropanoic acid, with the CAS number 87545-58-2, is a chemical compound characterized by its complex structure, which includes an imidazo-benzothiazole moiety and a phenoxy group. This compound typically exhibits properties associated with both aromatic and heterocyclic compounds, contributing to its potential biological activity. It may possess acidic characteristics due to the carboxylic acid functional group (-COOH) present in its structure, influencing its solubility and reactivity in various solvents. The presence of the imidazo and benzothiazole rings suggests potential interactions with biological targets, making it of interest in medicinal chemistry. Additionally, the compound's unique structural features may confer specific electronic properties, affecting its behavior in chemical reactions and interactions. Overall, this compound's characteristics make it a subject of interest for further research, particularly in the fields of pharmaceuticals and organic synthesis.
Formula:C18H12N2O4S
InChI:InChI=1/C18H12N2O4S/c21-16(22)9-17(23)24-12-5-3-4-11(8-12)13-10-20-14-6-1-2-7-15(14)25-18(20)19-13/h1-8,10H,9H2,(H,21,22)
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.