CAS 875514-62-8
:8-bromo-1,6-naphthyridine-2-carboxamide
Description:
8-Bromo-1,6-naphthyridine-2-carboxamide is a chemical compound characterized by its naphthyridine core, which features a bromine substituent at the 8-position and a carboxamide functional group at the 2-position. This compound typically exhibits properties associated with heterocyclic aromatic compounds, including potential solubility in polar solvents due to the presence of the carboxamide group. The bromine atom can influence the compound's reactivity, making it a useful intermediate in organic synthesis and medicinal chemistry. The presence of the naphthyridine structure suggests potential biological activity, as many derivatives of naphthyridine are known to exhibit pharmacological properties. Additionally, the compound may participate in hydrogen bonding due to the carboxamide group, which can affect its interactions in biological systems. Its molecular structure allows for various substitution reactions, making it a versatile building block in the development of new chemical entities. Overall, 8-bromo-1,6-naphthyridine-2-carboxamide is of interest in both synthetic and medicinal chemistry contexts.
Formula:C9H6BrN3O
InChI:InChI=1/C9H6BrN3O/c10-6-4-12-3-5-1-2-7(9(11)14)13-8(5)6/h1-4H,(H2,11,14)
Synonyms:- 8-Bromo-[1,6]naphthyridine-2-carboxylic acid amide
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.