CAS 87553-74-0
:tert-butyl D-tyrosinate
Description:
Tert-butyl D-tyrosinate is an organic compound that belongs to the class of amino acid derivatives, specifically a derivative of the amino acid tyrosine. It features a tert-butyl group, which enhances its lipophilicity and stability, making it useful in various chemical applications. The compound is characterized by its structure, which includes a phenolic hydroxyl group typical of tyrosine, contributing to its potential biological activity. Tert-butyl D-tyrosinate is often utilized in peptide synthesis and as a building block in medicinal chemistry due to its ability to participate in various chemical reactions, including coupling reactions. Its solubility properties are influenced by the tert-butyl group, allowing for better solubility in organic solvents compared to its parent amino acid. Additionally, the compound may exhibit specific optical activity due to the presence of the chiral center associated with the D-tyrosine configuration. Overall, tert-butyl D-tyrosinate is a versatile compound with applications in both research and pharmaceutical development.
Formula:C13H19NO3
InChI:InChI=1/C13H19NO3/c1-13(2,3)17-12(16)11(14)8-9-4-6-10(15)7-5-9/h4-7,11,15H,8,14H2,1-3H3/t11-/m1/s1
SMILES:CC(C)(C)OC(=O)[C@@H](Cc1ccc(cc1)O)N
Synonyms:- D-Tyrosine, 1,1-dimethylethyl ester
- D-Tyrosine tert.butyl ester
- H-D-Tyr-Otbu
- tert-Butyl D-tyrosinate
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 4 products.
D-Tyrosine tert-butyl ester, 98%
CAS:<p>D-Tyrosine tert-butyl ester, is used as a pharmaceutical intermediate. This Thermo Scientific Chemicals brand product was originally part of the Alfa Aesar product portfolio. Some documentation and label information may refer to the legacy brand. The original Alfa Aesar product / item code or SKU re</p>Formula:C13H19NO3Purity:98%Molecular weight:237.30
