CAS 87553-88-6
:4,6-Dichloro-2(3H)-benzothiazolone
Description:
4,6-Dichloro-2(3H)-benzothiazolone is an organic compound characterized by its heterocyclic structure, which includes a benzothiazole ring with two chlorine substituents at the 4 and 6 positions. This compound is typically used as a biocide and fungicide due to its antimicrobial properties, making it valuable in various industrial applications, including water treatment and preservation of materials. It is known for its stability under normal conditions, but it may decompose when exposed to strong acids or bases. The compound is generally soluble in organic solvents but has limited solubility in water. Safety considerations are important when handling this substance, as it may pose health risks if inhaled or ingested, and appropriate protective measures should be taken. Additionally, its environmental impact should be assessed, particularly regarding aquatic toxicity. Overall, 4,6-Dichloro-2(3H)-benzothiazolone is a significant compound in the field of chemistry, particularly in applications requiring effective antimicrobial agents.
Formula:C7H3Cl2NOS
InChI:InChI=1S/C7H3Cl2NOS/c8-3-1-4(9)6-5(2-3)12-7(11)10-6/h1-2H,(H,10,11)
InChI key:InChIKey=FAJYYCLIPJHGRV-UHFFFAOYSA-N
SMILES:ClC1=C2C(SC(=O)N2)=CC(Cl)=C1
Synonyms:- 4,6-Dichloro-2(3H)-benzothiazolone
- 2(3H)-Benzothiazolone, 4,6-dichloro-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
