CAS 875548-60-0

4-[[[(1,1-Dimethylethyl)dimethylsilyl]oxy]methyl]-2-iodothiazole

Description:

4-[[[(1,1-Dimethylethyl)dimethylsilyl]oxy]methyl]-2-iodothiazole is a chemical compound characterized by its unique structural features, which include a thiazole ring, an iodine atom, and a silyl ether functional group. The presence of the thiazole moiety suggests potential biological activity, as thiazoles are often found in pharmaceuticals and agrochemicals. The dimethylethylsilyl group enhances the compound's stability and solubility, making it suitable for various applications in organic synthesis and material science. The iodine atom may impart specific reactivity, allowing for further functionalization or use in radiolabeling. This compound is likely to be a solid at room temperature, with properties influenced by its molecular weight and functional groups. Its synthesis and handling would require standard laboratory safety protocols due to the presence of iodine and the potential reactivity of the thiazole ring. Overall, this compound exemplifies the complexity and versatility of organosilicon compounds in modern chemistry.

Formula: C₁₀H₁₈INOSSi

InChI: InChI=1S/C10H18INOSSi/c1-10(2,3)15(4,5)13-6-8-7-14-9(11)12-8/h7H,6H2,1-5H3

InChI key: InChIKey=VSGUNQSEXUIIEI-UHFFFAOYSA-N

SMILES: C(O[Si](C(C)(C)C)(C)C)C1=CSC(I)=N1

Synonyms:

• 4-[[[(1,1-Dimethylethyl)dimethylsilyl]oxy]methyl]-2-iodothiazole
• Thiazole, 4-[[[(1,1-dimethylethyl)dimethylsilyl]oxy]methyl]-2-iodo-
• 4-[[(tert-Butyldimethylsilyl)oxy]methyl]-2-iodo-1,3-thiazole