CymitQuimica logo

CAS 875558-27-3

:

[1-tert-butoxycarbonyl-6-(trifluoromethyl)indol-2-yl]boronic acid

Description:
[1-tert-butoxycarbonyl-6-(trifluoromethyl)indol-2-yl]boronic acid is a boronic acid derivative characterized by its unique structural features, including an indole core substituted with a tert-butoxycarbonyl (Boc) group and a trifluoromethyl group. The presence of the boronic acid functional group imparts significant reactivity, particularly in Suzuki coupling reactions, making it valuable in organic synthesis and medicinal chemistry. The trifluoromethyl group enhances lipophilicity and can influence the compound's biological activity, while the Boc group serves as a protective moiety that can be removed under acidic conditions, allowing for further functionalization. This compound is typically used in the development of pharmaceuticals and agrochemicals, where its ability to form stable complexes with various substrates is advantageous. Additionally, the compound's solubility and stability in various solvents can vary, which is important for its application in synthetic pathways. Overall, its unique combination of functional groups makes it a versatile building block in chemical synthesis.
Formula:C14H15BF3NO4
InChI:InChI=1/C14H15BF3NO4/c1-13(2,3)23-12(20)19-10-7-9(14(16,17)18)5-4-8(10)6-11(19)15(21)22/h4-7,21-22H,1-3H3
SMILES:CC(C)(C)OC(=O)n1c2cc(ccc2cc1B(O)O)C(F)(F)F
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.