CAS 87556-66-9
:S-(Chloromethyl) (6α,11β,16α,17α)-6,9-difluoro-11,17-dihydroxy-16-methyl-3-oxoandrosta-1,4-diene-17-carbothioate
Description:
S-(Chloromethyl) (6α,11β,16α,17α)-6,9-difluoro-11,17-dihydroxy-16-methyl-3-oxoandrosta-1,4-diene-17-carbothioate, with CAS number 87556-66-9, is a synthetic steroid compound characterized by its complex molecular structure, which includes multiple functional groups such as fluorine, hydroxyl, and a carbothioate moiety. This compound is part of the androstane family, which is known for its biological activity, particularly in the context of hormone modulation. The presence of fluorine atoms typically enhances the compound's metabolic stability and bioactivity. The chloromethyl group suggests potential reactivity, allowing for further chemical modifications. Its specific stereochemistry, indicated by the various alpha and beta designations, plays a crucial role in determining its biological interactions and pharmacological properties. Such compounds are often studied for their potential therapeutic applications, including anti-inflammatory or anabolic effects, although their safety and efficacy would require thorough investigation in clinical settings. Overall, this compound exemplifies the intricate design of synthetic steroids aimed at targeting specific biological pathways.
Formula:C22H27ClF2O4S
InChI:InChI=1S/C22H27ClF2O4S/c1-11-6-13-14-8-16(24)15-7-12(26)4-5-19(15,2)21(14,25)17(27)9-20(13,3)22(11,29)18(28)30-10-23/h4-5,7,11,13-14,16-17,27,29H,6,8-10H2,1-3H3/t11-,13+,14+,16+,17+,19+,20+,21+,22+/m1/s1
InChI key:InChIKey=ANLWAEZHUOEOTI-GQKYHHCASA-N
SMILES:C[C@@]12[C@]([C@]3([C@@](F)([C@]4(C)C([C@@H](F)C3)=CC(=O)C=C4)[C@@H](O)C1)[H])(C[C@@H](C)[C@@]2(C(SCCl)=O)O)[H]
Synonyms:- Androsta-1,4-diene-17-carbothioic acid, 6,9-difluoro-11,17-dihydroxy-16-methyl-3-oxo-, S-(chloromethyl) ester, (6α,11β,16α,17α)-
- Cloticasanum
- Cloticasone [INN:BAN]
- S-(Chloromethyl 6alpha,9-difluoro-11beta,17-dihydroxy-16alpha-methyl-3-oxoandrosta-1,4-diene-17beta-carbothioate
- S-(Chloromethyl) (6α,11β,16α,17α)-6,9-difluoro-11,17-dihydroxy-16-methyl-3-oxoandrosta-1,4-diene-17-carbothioate
- Unii-6Cn32Zuq4X
- Cloticasone
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
Cloticasone
CAS:Controlled Product<p>Applications Cloticasone is an intermediate in the synthesis of Fluticasone Propionate.<br>References Meltzer, E.O., et al.: J. Allergy Clin. Immunol., 86, 221 (1990), Mitchison, H.C., et al.: Gut, 32, 260 (1991), Phillipps, G.H., et al.: J. Med. Chem., 37, 3717 (1994)<br></p>Formula:C22H27ClF2O4SColor and Shape:NeatMolecular weight:460.96
