CymitQuimica logo

CAS 875573-64-1

:

(7α,17β)-17-(Acetyloxy)-7-(9-hydroxynonyl)estr-4-en-3-one

Description:
The chemical substance known as "(7α,17β)-17-(Acetyloxy)-7-(9-hydroxynonyl)estr-4-en-3-one," with the CAS number 875573-64-1, is a synthetic steroid derivative. It features a steroid backbone characteristic of estrogens, with specific modifications that include an acetyloxy group and a hydroxynonyl side chain. This compound is likely to exhibit biological activity related to estrogenic effects, potentially influencing various physiological processes such as reproductive functions and hormonal regulation. The presence of the acetyloxy group may enhance its lipophilicity, affecting its absorption and distribution in biological systems. Additionally, the hydroxynonyl moiety could contribute to its binding affinity to estrogen receptors. As with many steroid derivatives, the compound may also possess anti-inflammatory or other pharmacological properties, making it of interest in medicinal chemistry and therapeutic applications. However, detailed studies would be necessary to fully elucidate its biological activity, pharmacokinetics, and potential therapeutic uses.
Formula:C29H46O4
InChI:InChI=1S/C29H46O4/c1-20(31)33-27-14-13-26-28-21(10-8-6-4-3-5-7-9-17-30)18-22-19-23(32)11-12-24(22)25(28)15-16-29(26,27)2/h19,21,24-28,30H,3-18H2,1-2H3/t21-,24+,25-,26+,27+,28-,29+/m1/s1
InChI key:InChIKey=GRPRLSJDURTSPV-OMQCHTGPSA-N
SMILES:C(CCCCCCCCO)[C@H]1[C@]2([C@]3([C@@](C)([C@@H](OC(C)=O)CC3)CC[C@@]2([C@@]4(C(C1)=CC(=O)CC4)[H])[H])[H])[H]
Synonyms:
  • Estr-4-en-3-one, 17-(acetyloxy)-7-(9-hydroxynonyl)-, (7α,17β)-
  • (7α,17β)-17-(Acetyloxy)-7-(9-hydroxynonyl)estr-4-en-3-one
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 2 products.