CymitQuimica logo

CAS 875573-67-4

:

(7a,17b)-7-(9-Bromononyl)estra-1,3,5(10)-triene-3,17-diol

Description:
The chemical substance known as (7a,17b)-7-(9-Bromononyl)estra-1,3,5(10)-triene-3,17-diol, with the CAS number 875573-67-4, is a synthetic derivative of estradiol, a naturally occurring estrogen. This compound features a complex steroid structure characterized by a triene system, which includes three conjugated double bonds, contributing to its potential biological activity. The presence of a bromononyl group indicates that it has a bromine atom attached to a nonyl chain, which may influence its lipophilicity and interaction with biological membranes. The hydroxyl groups at positions 3 and 17 suggest that it may exhibit estrogenic activity, potentially binding to estrogen receptors and influencing various physiological processes. The specific stereochemistry, indicated by the (7a,17b) notation, is crucial for its biological function and activity. Overall, this compound may be of interest in medicinal chemistry and pharmacology, particularly in the study of hormone-related therapies or as a research tool in understanding estrogenic mechanisms.
Formula:C27H41BrO2
InChI:InChI=1S/C27H41BrO2/c1-27-15-14-23-22-11-10-21(29)18-20(22)17-19(26(23)24(27)12-13-25(27)30)9-7-5-3-2-4-6-8-16-28/h10-11,18-19,23-26,29-30H,2-9,12-17H2,1H3/t19-,23-,24+,25+,26-,27+/m1/s1
InChI key:ILWDBZWOZQESSY-NJGGNICLSA-N
SMILES:C[C@]12CC[C@H]3[C@H]([C@@H]1CC[C@@H]2O)[C@@H](CC4=C3C=CC(=C4)O)CCCCCCCCCBr
Found 3 products.