CymitQuimica logo

CAS 875639-25-1

:

3-(2,3-Dihydro-7-benzofuranyl)-1-[(4-methylphenyl)sulfonyl]-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-1H-pyrrolo[2,3-b]pyridine

Description:
The chemical substance known as 3-(2,3-Dihydro-7-benzofuranyl)-1-[(4-methylphenyl)sulfonyl]-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-1H-pyrrolo[2,3-b]pyridine, with the CAS number 875639-25-1, is a complex organic compound characterized by its multi-functional structure. It features a pyrrolo[2,3-b]pyridine core, which is a bicyclic compound known for its potential biological activity. The presence of a benzofuran moiety contributes to its aromatic character, while the sulfonyl group enhances its reactivity and solubility in various solvents. The incorporation of a boron-containing group, specifically a dioxaborolane, suggests potential applications in medicinal chemistry, particularly in drug design and development, as boron compounds can play a role in biological interactions. This compound may exhibit unique pharmacological properties due to its diverse functional groups, making it a subject of interest in research related to therapeutic agents. Its stability, solubility, and reactivity would depend on the specific conditions under which it is studied.
Formula:C28H29BN2O5S
InChI:InChI=1S/C28H29BN2O5S/c1-18-9-11-21(12-10-18)37(32,33)31-17-24(22-8-6-7-19-13-14-34-25(19)22)23-15-20(16-30-26(23)31)29-35-27(2,3)28(4,5)36-29/h6-12,15-17H,13-14H2,1-5H3
InChI key:InChIKey=NAQKQBRABZRGTP-UHFFFAOYSA-N
SMILES:S(=O)(=O)(N1C=2C(C(=C1)C3=C4C(=CC=C3)CCO4)=CC(=CN2)B5OC(C)(C)C(C)(C)O5)C6=CC=C(C)C=C6
Synonyms:
  • 1H-Pyrrolo[2,3-b]pyridine, 3-(2,3-dihydro-7-benzofuranyl)-1-[(4-methylphenyl)sulfonyl]-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-
  • 3-(2,3-Dihydro-7-benzofuranyl)-1-[(4-methylphenyl)sulfonyl]-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-1H-pyrrolo[2,3-b]pyridine
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.