CAS 875654-34-5

B-[5-Methoxy-2-(methoxymethoxy)-4-(1-methylethoxy)phenyl]boronic acid

Description:

B-[5-Methoxy-2-(methoxymethoxy)-4-(1-methylethoxy)phenyl]boronic acid is an organoboron compound characterized by the presence of a boronic acid functional group, which is known for its ability to form reversible covalent bonds with diols, making it useful in various applications, including organic synthesis and medicinal chemistry. The compound features a phenyl ring substituted with multiple methoxy groups, which enhance its solubility and reactivity. The presence of the boronic acid moiety allows for participation in cross-coupling reactions, such as Suzuki-Miyaura coupling, facilitating the formation of carbon-carbon bonds. Additionally, the methoxy substituents can influence the electronic properties of the molecule, potentially affecting its reactivity and interaction with biological targets. This compound may be of interest in the development of pharmaceuticals or as a building block in organic synthesis due to its unique structural features and functional versatility. Its specific properties, such as solubility, stability, and reactivity, would depend on the surrounding conditions and the presence of other reagents.

Formula: C₁₂H₁₉BO₆

InChI: InChI=1S/C12H19BO6/c1-8(2)19-12-6-10(18-7-16-3)9(13(14)15)5-11(12)17-4/h5-6,8,14-15H,7H2,1-4H3

InChI key: InChIKey=FOMSTONHGHCDPF-UHFFFAOYSA-N

SMILES: O(COC)C1=C(B(O)O)C=C(OC)C(OC(C)C)=C1

Synonyms:

• (4-Isopropoxy-5-methoxy-2-methoxymethoxyphenyl)boronic acid
• Boronic acid, [5-methoxy-2-(methoxymethoxy)-4-(1-methylethoxy)phenyl]-
• B-[5-Methoxy-2-(methoxymethoxy)-4-(1-methylethoxy)phenyl]boronic acid
• Boronic acid, B-[5-methoxy-2-(methoxymethoxy)-4-(1-methylethoxy)phenyl]-

Boronic acid, B-[5-methoxy-2-(methoxymethoxy)-4-(1-methylethoxy)phenyl]-

CAS: 875654-34-5

Formula: C₁₂H₁₉BO₆

Molecular weight: 270.0867

Ref: IN-DA01PJJS