
CAS 875664-28-1
:2-Bromo-5-(1,1-dimethylethyl)benzaldehyde
Description:
2-Bromo-5-(1,1-dimethylethyl)benzaldehyde is an organic compound characterized by its aromatic structure, featuring a bromine atom and a bulky tert-butyl group attached to a benzaldehyde moiety. The presence of the bromine substituent at the 2-position and the tert-butyl group at the 5-position of the benzene ring influences its reactivity and physical properties. This compound is typically a colorless to pale yellow liquid or solid, depending on the temperature and purity. It exhibits a distinct aromatic odor, characteristic of benzaldehyde derivatives. The bromine atom introduces a polar functional group, which can enhance the compound's solubility in polar solvents while maintaining some hydrophobic characteristics due to the tert-butyl group. Additionally, 2-Bromo-5-(1,1-dimethylethyl)benzaldehyde can participate in various chemical reactions, including electrophilic aromatic substitution and nucleophilic addition, making it a valuable intermediate in organic synthesis. Its unique structure and properties may also lend it potential applications in pharmaceuticals, agrochemicals, and materials science.
Formula:C11H13BrO
InChI:InChI=1S/C11H13BrO/c1-11(2,3)9-4-5-10(12)8(6-9)7-13/h4-7H,1-3H3
InChI key:InChIKey=DWEWHEDCZHKXHK-UHFFFAOYSA-N
SMILES:C(C)(C)(C)C1=CC(C=O)=C(Br)C=C1
Synonyms:- 2-Bromo-5-tert-butylbenzaldehyde
- Benzaldehyde, 2-bromo-5-(1,1-dimethylethyl)-
- 2-Bromo-5-(1,1-dimethylethyl)benzaldehyde
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.