CAS 875664-32-7
:2-Bromo-5-(trifluoromethyl)benzyl bromide
Description:
2-Bromo-5-(trifluoromethyl)benzyl bromide is an organic compound characterized by its bromobenzyl structure, which includes a bromine atom at the second position and a trifluoromethyl group at the fifth position of the benzene ring. This compound is typically a colorless to pale yellow liquid or solid, depending on its purity and temperature. It is known for its reactivity due to the presence of multiple bromine atoms, making it a useful intermediate in organic synthesis, particularly in the development of pharmaceuticals and agrochemicals. The trifluoromethyl group enhances the lipophilicity and metabolic stability of the compound, which can influence its biological activity. Additionally, 2-Bromo-5-(trifluoromethyl)benzyl bromide may exhibit significant polar characteristics due to the electronegative fluorine atoms, affecting its solubility in various solvents. Safety precautions should be taken when handling this compound, as it may pose health risks and environmental hazards. Proper storage and disposal methods are essential to mitigate any potential risks associated with its use.
Formula:C8H5Br2F3
InChI:InChI=1/C8H5Br2F3/c9-4-5-3-6(8(11,12)13)1-2-7(5)10/h1-3H,4H2
SMILES:c1cc(c(cc1C(F)(F)F)CBr)Br
Synonyms:- 1-Bromo-2-(bromomethyl)-4-(trifluoromethyl)benzene
- Benzene, 1-bromo-2-(bromomethyl)-4-(trifluoromethyl)-
- Fxffr De C1E
- 2-Bromo-5-(trifluoromethyl)benzylbromide
- 2-Bromo-5-Trifluoromethylbenzyl Bromide
- 2-BROMO-5-(TRIFLUOROMETHYL)BENZYL BROMIDE
- 2-Bromo-5-(trifluoromethyl)BenzylBromide97+%
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
Benzene, 1-bromo-2-(bromomethyl)-4-(1,1-dimethylethyl)-
CAS:Formula:C11H14Br2Color and Shape:LiquidMolecular weight:306.0369

