CAS 875664-52-1

3,4-Difluoro-2-methoxybenzoic acid

Description:

3,4-Difluoro-2-methoxybenzoic acid is an aromatic carboxylic acid characterized by the presence of two fluorine atoms and a methoxy group on a benzoic acid framework. The fluorine substituents are located at the 3 and 4 positions of the benzene ring, while the methoxy group is positioned at the 2 position, influencing the compound's electronic properties and reactivity. This compound typically exhibits moderate solubility in organic solvents and may have limited solubility in water due to the hydrophobic nature of the aromatic ring and the methoxy group. The presence of fluorine atoms can enhance the compound's lipophilicity and may affect its biological activity, making it of interest in pharmaceutical research. Additionally, the carboxylic acid functional group contributes to its acidity and potential for forming hydrogen bonds, which can influence its interactions in various chemical environments. Overall, 3,4-Difluoro-2-methoxybenzoic acid is a compound of interest in both synthetic organic chemistry and medicinal chemistry due to its unique structural features.

Formula: C₈H₆F₂O₃

InChI: InChI=1/C8H5BrF3NO/c9-7-2-5(4-13-14)1-6(3-7)8(10,11)12/h1-4,14H/b13-4+

InChI key: InChIKey=BGBIVLWLYHILBQ-UHFFFAOYSA-N

SMILES: O(C)C1=C(C(O)=O)C=CC(F)=C1F

Synonyms:

• (E)-1-[3-bromo-5-(trifluoromethyl)phenyl]-N-hydroxymethanimine
• Benzoic acid, 3,4-difluoro-2-methoxy-
• 3,4-Difluoro-2-methoxybenzoic acid
• 3,4-Difluoro-2-methoxyBenzoicacid98+%
• 3,4-Difluoro-2-methoxybenzoic acid 97+%

3,4-Difluoro-2-methoxybenzoic acid

CAS: 875664-52-1

Formula: C₈H₆F₂O₃

Purity: 98%

Color and Shape: Solid

Molecular weight: 188.1282

Ref: IN-DA003IGR

3,4-Difluoro-2-methoxybenzoic acid

CAS: 875664-52-1

3,4-Difluoro-2-methoxybenzoic acid

Formula: C₈H₆F₂O₃

Purity: 97%

Color and Shape: white crystalline needles

Molecular weight: 188.13g/mol

Ref: 54-PC7836

3,4-Difluoro-2-methoxybenzoic acid

CAS: 875664-52-1

3,4-Difluoro-2-methoxybenzoic acid is a chemical compound that can be used as a reaction component or reagent. It is also a useful scaffold for organic synthesis of complex compounds and can be used as a building block to produce fine chemicals. 3,4-Difluoro-2-methoxybenzoic acid has the CAS number 875664-52-1 and is listed under the chemical name 3,4-difluoro-2-methoxybenzoic acid.

Formula: C₈H₆F₂O₃

Purity: Min. 95%

Color and Shape: Powder

Molecular weight: 188.13 g/mol

Ref: 3D-FD70086

3,4-Difluoro-2-methoxybenzoic acid

CAS: 875664-52-1

Formula: C₈H₆F₂O₃

Purity: 97%

Color and Shape: Solid

Molecular weight: 188.13

Ref: 10-F013819