CAS 875664-57-6
:4,5-Difluoro-2-methylaniline
Description:
4,5-Difluoro-2-methylaniline is an organic compound characterized by the presence of two fluorine atoms and a methyl group attached to an aniline structure. Its molecular formula is C8H8F2N, indicating it contains eight carbon atoms, eight hydrogen atoms, two fluorine atoms, and one nitrogen atom. The compound features a benzene ring with an amino group (-NH2) and exhibits properties typical of substituted anilines, such as being a weak base due to the presence of the amino group. The fluorine substituents can influence the compound's reactivity and polarity, potentially enhancing its solubility in polar solvents. 4,5-Difluoro-2-methylaniline may be used in various applications, including as an intermediate in the synthesis of pharmaceuticals, agrochemicals, or other organic compounds. Its specific physical properties, such as melting point, boiling point, and solubility, would depend on the molecular interactions and the presence of functional groups. Safety data should be consulted for handling and usage, as with any chemical substance.
Formula:C7H7F2N
InChI:InChI=1/C7H7F2N/c1-4-2-5(8)6(9)3-7(4)10/h2-3H,10H2,1H3
SMILES:Cc1cc(c(cc1N)F)F
Synonyms:- Benzenamine, 4,5-difluoro-2-methyl-
- 4,5-Difluoro-2-methylaniline
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 4 products.
4,5-Difluoro-2-methylaniline
CAS:Formula:C7H7F2NPurity:98%Color and Shape:SolidMolecular weight:143.13404,5-Difluoro-2-methylaniline
CAS:4,5-Difluoro-2-methylanilineFormula:C7H7F2NPurity:95%Color and Shape: off-white crystalline powderMolecular weight:143.13g/mol4,5-Difluoro-2-methylaniline
CAS:Formula:C7H7F2NPurity:95%Color and Shape:SolidMolecular weight:143.1374,5-Difluoro-2-methylaniline
CAS:4,5-Difluoro-2-methylaniline is a chemical intermediate that is used as a reaction component in the synthesis of organic compounds. It is a fine chemical with CAS No. 875664-57-6, and it can be used as a building block for the synthesis of complex organic molecules. This reagent is useful for the production of pharmaceuticals, agrochemicals, and other specialty chemicals. 4,5-Difluoro-2-methylaniline has been shown to act as an intermediate for the synthesis of many different types of compounds, including complex compounds such as imidazole derivatives and N-(4-fluorophenyl)benzo[d]oxazole derivatives.
Formula:C7H7F2NPurity:Min. 95%Color and Shape:Off-White PowderMolecular weight:143.13 g/molRef: 3D-FD67856
Discontinued product



