
CAS 875769-11-2
:5-[(3,3-Dimethyl-2-oxido-1-triazen-1-yl)oxy]-2,4-dinitrophenyl 4-(methylamino)benzoate
Description:
5-[(3,3-Dimethyl-2-oxido-1-triazen-1-yl)oxy]-2,4-dinitrophenyl 4-(methylamino)benzoate, with CAS number 875769-11-2, is a chemical compound characterized by its complex structure, which includes a dinitrophenyl moiety and a triazenyl group. This compound features a triazenyl functional group, which is known for its potential biological activity, particularly in the context of medicinal chemistry and as a potential anticancer agent. The presence of the dinitrophenyl group suggests that it may exhibit strong electron-withdrawing properties, which can influence its reactivity and interactions with biological targets. Additionally, the methylamino substituent may enhance its solubility and bioavailability. The compound's unique combination of functional groups may contribute to its pharmacological properties, making it a subject of interest in drug development. However, detailed studies on its toxicity, stability, and specific biological effects would be necessary to fully understand its potential applications and safety profile.
Formula:C16H16N6O8
InChI:InChI=1S/C16H16N6O8/c1-17-11-6-4-10(5-7-11)16(23)29-14-9-15(30-18-22(28)19(2)3)13(21(26)27)8-12(14)20(24)25/h4-9,17H,1-3H3
InChI key:InChIKey=DZJYJYAXGBNEMK-UHFFFAOYSA-N
SMILES:O(C(=O)C1=CC=C(NC)C=C1)C2=C(N(=O)=O)C=C(N(=O)=O)C(ON=N(N(C)C)=O)=C2
Synonyms:- 5-[(3,3-Dimethyl-2-oxido-1-triazen-1-yl)oxy]-2,4-dinitrophenyl 4-(methylamino)benzoate
- Benzoic acid, 4-(methylamino)-, 5-[(3,3-dimethyl-2-oxido-1-triazen-1-yl)oxy]-2,4-dinitrophenyl ester
- Benzoic acid, 4-(methylamino)-, 5-[(3,3-dimethyl-2-oxido-1-triazenyl)oxy]-2,4-dinitrophenyl ester
- PABA/NO
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
PABA/NO
CAS:<p>PABA/NO, a GST-activated NO donor, hampers hepatocellular carcinoma growth and survival by disrupting PI3K/AKT/mTOR and MEK/ERK.</p>Formula:C16H16N6O8Color and Shape:SolidMolecular weight:420.33
