
CAS 875770-33-5
:1-(1,3-Cyclopentadien-1-yl)-3,6,9,12-tetraoxapentadec-14-yne
Description:
1-(1,3-Cyclopentadien-1-yl)-3,6,9,12-tetraoxapentadec-14-yne, with the CAS number 875770-33-5, is a complex organic compound characterized by its unique structure that includes a cyclopentadiene moiety and multiple ether linkages. This compound features a long carbon chain with four ether functional groups, which contribute to its solubility and reactivity. The presence of the cyclopentadiene ring suggests potential for participation in various chemical reactions, including Diels-Alder reactions, due to its conjugated double bonds. The tetraoxapentadec structure indicates that it may exhibit interesting properties related to its molecular weight and polarity. Additionally, the presence of the alkyne functional group may allow for further functionalization or polymerization reactions. Overall, this compound's unique structural features may lend it applications in materials science, organic synthesis, or as a potential ligand in coordination chemistry. However, specific physical properties such as melting point, boiling point, and solubility would require empirical data for precise characterization.
Formula:C16H24O4
InChI:InChI=1S/C16H24O4/c1-2-8-17-10-12-19-14-15-20-13-11-18-9-7-16-5-3-4-6-16/h1,3-5H,6-15H2
InChI key:InChIKey=YKWNRYVNFUQSGU-UHFFFAOYSA-N
SMILES:C(COCCOCCOCCOCC#C)C=1CC=CC1
Synonyms:- 1-(1,3-Cyclopentadien-1-yl)-3,6,9,12-tetraoxapentadec-14-yne
- 3,6,9,12-Tetraoxapentadec-14-yne, 1-(1,3-cyclopentadien-1-yl)-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
3,6,9,12-Tetraoxapentadec-14-yne, 1-(1,3-cyclopentadien-1-yl)-
CAS:Formula:C16H24O4Molecular weight:280.3594
