CAS 875781-44-5

5H-Pyrrolo[2,3-b]pyrazine,2-bromo-7-iodo-

Description:

5H-Pyrrolo[2,3-b]pyrazine, 2-bromo-7-iodo- is a heterocyclic organic compound characterized by its fused pyrrole and pyrazine rings, which contribute to its unique chemical properties. The presence of bromine and iodine substituents at the 2 and 7 positions, respectively, enhances its reactivity and potential applications in various fields, including medicinal chemistry and materials science. This compound may exhibit interesting biological activities due to its structural features, making it a candidate for further research in drug development. Additionally, the halogen substituents can influence its electronic properties and solubility, which are crucial for its behavior in chemical reactions and interactions with biological targets. As a member of the pyrrolo-pyrazine family, it may also participate in diverse synthetic pathways, allowing for the derivation of more complex molecules. Overall, 5H-Pyrrolo[2,3-b]pyrazine, 2-bromo-7-iodo- is a compound of interest for its potential applications in various scientific domains.

Formula: C₆H₃BrIN₃

InChI: InChI=1S/C6H3BrIN3/c7-4-2-10-6-5(11-4)3(8)1-9-6/h1-2H,(H,9,10)

SMILES: c1c(c2c([nH]1)ncc(Br)n2)I

Synonyms:

• 4H-Pyrrolo[2,3-b]pyrazine,2-bromo-7-iodo- (9CI)
• 2-Bromo-7-iodo-5H-pyrrolo[2,3-b]pyrazine
• 2-Bromo-7-iodo-5H-pyrrolo[3,2-b]pyrazine
• 5-Bromo-3-iodo-4,7-diazaindole

5-Bromo-3-iodo-4,7-diazaindole

CAS: 875781-44-5

Formula: C₆H₃BrIN₃

Purity: 96%

Color and Shape: Solid

Molecular weight: 323.9166

Ref: IN-DA003GR7

2-Bromo-7-iodo-5H-pyrrolo[2,3-b]pyrazine

CAS: 875781-44-5

2-Bromo-7-iodo-5H-pyrrolo[2,3-b]pyrazine

Purity: 97%

Molecular weight: 323.92g/mol

Ref: 54-OR90606

2-Bromo-7-iodo-5H-pyrrolo[2,3-b]pyrazine

CAS: 875781-44-5

Purity: 95%

Molecular weight: 323.917

Ref: FT-B12611

5-Bromo-3-iodo-4,7-diazaindole

CAS: 875781-44-5

Formula: C₆H₃BrIN₃

Purity: 96%

Color and Shape: Solid

Molecular weight: 323.919

Ref: 10-F076917