CymitQuimica logo

CAS 875781-45-6

:

2-bromo-7-iodo-5-(p-tolylsulfonyl)pyrrolo[2,3-b]pyrazine

Description:
2-Bromo-7-iodo-5-(p-tolylsulfonyl)pyrrolo[2,3-b]pyrazine is a complex organic compound characterized by its unique heterocyclic structure, which includes both pyrrole and pyrazine rings. This compound features a bromine and iodine substituent, contributing to its reactivity and potential applications in medicinal chemistry. The presence of the p-tolylsulfonyl group enhances its solubility and may influence its biological activity, making it a candidate for various pharmaceutical applications. The molecular structure suggests potential for interactions with biological targets, possibly acting as a ligand or inhibitor. Additionally, the halogen atoms (bromine and iodine) can facilitate further chemical modifications, allowing for the synthesis of derivatives with tailored properties. The compound's stability, solubility, and reactivity are influenced by its functional groups and overall molecular geometry. As with many heterocyclic compounds, it may exhibit interesting electronic properties, making it a subject of interest in both organic synthesis and materials science.
Formula:C13H9BrIN3O2S
InChI:InChI=1/C13H9BrIN3O2S/c1-8-2-4-9(5-3-8)21(19,20)18-7-10(15)12-13(18)16-6-11(14)17-12/h2-7H,1H3
InChI key:QONWBLJGJMTBKI-UHFFFAOYSA-N
SMILES:Cc1ccc(cc1)S(=O)(=O)n1cc(c2c1ncc(Br)n2)I
Found 4 products.