CymitQuimica logo

CAS 87579-79-1

:

Diphenylmethyl (αR,2R)-2-(2-benzothiazolyldithio)-α-(1-methylethenyl)-4-oxo-1-azetidineacetate

Description:
Diphenylmethyl (αR,2R)-2-(2-benzothiazolyldithio)-α-(1-methylethenyl)-4-oxo-1-azetidineacetate is a complex organic compound characterized by its unique structural features, including a bicyclic azetidine ring and multiple functional groups. The presence of a benzothiazole moiety contributes to its potential biological activity, while the diphenylmethyl group enhances its lipophilicity. This compound may exhibit properties such as antimicrobial or anticancer activity, which are common in compounds containing benzothiazole derivatives. Its molecular structure suggests it could participate in various chemical reactions, including nucleophilic substitutions or cycloadditions, due to the presence of reactive functional groups. Additionally, the stereochemistry indicated by the αR and 2R configurations suggests that the compound may exhibit specific interactions with biological targets, influencing its pharmacological profile. As with many synthetic organic compounds, its solubility, stability, and reactivity can vary based on environmental conditions, making it a subject of interest in medicinal chemistry and drug development.
Formula:C28H24N2O3S3
InChI:InChI=1S/C28H24N2O3S3/c1-18(2)25(27(32)33-26(19-11-5-3-6-12-19)20-13-7-4-8-14-20)30-23(31)17-24(30)35-36-28-29-21-15-9-10-16-22(21)34-28/h3-16,24-26H,1,17H2,2H3/t24-,25-/m1/s1
InChI key:InChIKey=LWPMPBXPAISDHI-JWQCQUIFSA-N
SMILES:[C@H](C(OC(C1=CC=CC=C1)C2=CC=CC=C2)=O)(C(C)=C)N3[C@H](SSC4=NC=5C(S4)=CC=CC5)CC3=O
Synonyms:
  • 1-Azetidineacetic acid, 2-(2-benzothiazolyldithio)-α-(1-methylethenyl)-4-oxo-, diphenylmethyl ester, (αR,2R)-
  • Diphenylmethyl (αR,2R)-2-(2-benzothiazolyldithio)-α-(1-methylethenyl)-4-oxo-1-azetidineacetate
  • 1-Azetidineacetic acid, 2-(2-benzothiazolyldithio)-α-(1-methylethenyl)-4-oxo-, diphenylmethyl ester, [R-(R*,R*)]-
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 3 products.