CAS 875895-65-1

Methyl 2-(bromomethyl)-3,4-dichlorobenzoate

Description:

Methyl 2-(bromomethyl)-3,4-dichlorobenzoate is an organic compound characterized by its complex structure, which includes a benzoate moiety with multiple halogen substituents. The presence of bromine and chlorine atoms indicates that it is a halogenated compound, which often imparts unique reactivity and physical properties. This compound features a methyl ester functional group, contributing to its solubility in organic solvents and potential applications in organic synthesis. The bromomethyl group suggests that it may participate in nucleophilic substitution reactions, making it a useful intermediate in the synthesis of more complex molecules. Additionally, the dichlorobenzoate structure may influence its electronic properties and reactivity patterns. As with many halogenated compounds, it is essential to handle this substance with care due to potential toxicity and environmental concerns. Overall, Methyl 2-(bromomethyl)-3,4-dichlorobenzoate is a versatile compound with applications in chemical research and synthesis, particularly in the development of pharmaceuticals and agrochemicals.

Formula: C₉H₇BrCl₂O₂

InChI: InChI=1S/C9H7BrCl2O2/c1-14-9(13)5-2-3-7(11)8(12)6(5)4-10/h2-3H,4H2,1H3

InChI key: InChIKey=GTXUTHFISYFGST-UHFFFAOYSA-N

SMILES: C(OC)(=O)C1=C(CBr)C(Cl)=C(Cl)C=C1

Synonyms:

• Methyl 2-(bromomethyl)-3,4-dichlorobenzoate
• Benzoic acid, 2-(bromomethyl)-3,4-dichloro-, methyl ester