
CAS 875895-65-1
:Methyl 2-(bromomethyl)-3,4-dichlorobenzoate
Description:
Methyl 2-(bromomethyl)-3,4-dichlorobenzoate is an organic compound characterized by its complex structure, which includes a benzoate moiety with multiple halogen substituents. The presence of bromine and chlorine atoms indicates that it is a halogenated compound, which often imparts unique reactivity and physical properties. This compound features a methyl ester functional group, contributing to its solubility in organic solvents and potential applications in organic synthesis. The bromomethyl group suggests that it may participate in nucleophilic substitution reactions, making it a useful intermediate in the synthesis of more complex molecules. Additionally, the dichlorobenzoate structure may influence its electronic properties and reactivity patterns. As with many halogenated compounds, it is essential to handle this substance with care due to potential toxicity and environmental concerns. Overall, Methyl 2-(bromomethyl)-3,4-dichlorobenzoate is a versatile compound with applications in chemical research and synthesis, particularly in the development of pharmaceuticals and agrochemicals.
Formula:C9H7BrCl2O2
InChI:InChI=1S/C9H7BrCl2O2/c1-14-9(13)5-2-3-7(11)8(12)6(5)4-10/h2-3H,4H2,1H3
InChI key:InChIKey=GTXUTHFISYFGST-UHFFFAOYSA-N
SMILES:C(OC)(=O)C1=C(CBr)C(Cl)=C(Cl)C=C1
Synonyms:- Methyl 2-(bromomethyl)-3,4-dichlorobenzoate
- Benzoic acid, 2-(bromomethyl)-3,4-dichloro-, methyl ester
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.