
CAS 87591-75-1
:6-Methyl-2-(trifluoromethyl)-4H-pyrido[1,2-a]pyrimidin-4-one
Description:
6-Methyl-2-(trifluoromethyl)-4H-pyrido[1,2-a]pyrimidin-4-one is a heterocyclic organic compound characterized by its complex bicyclic structure, which incorporates both pyridine and pyrimidine rings. This compound features a methyl group and a trifluoromethyl group, which significantly influence its chemical reactivity and physical properties. The presence of the trifluoromethyl group enhances lipophilicity and can affect the compound's biological activity, making it of interest in medicinal chemistry. The compound is typically solid at room temperature and may exhibit moderate solubility in organic solvents. Its unique structure allows for potential applications in pharmaceuticals, particularly as a scaffold for drug development targeting various biological pathways. Additionally, the compound's stability and reactivity can be influenced by the electron-withdrawing nature of the trifluoromethyl group, which can affect its interactions with other molecules. Overall, 6-Methyl-2-(trifluoromethyl)-4H-pyrido[1,2-a]pyrimidin-4-one represents a valuable compound for research in organic synthesis and drug discovery.
Formula:C10H7F3N2O
InChI:InChI=1S/C10H7F3N2O/c1-6-3-2-4-8-14-7(10(11,12)13)5-9(16)15(6)8/h2-5H,1H3
InChI key:InChIKey=SDSJEPDKNIUJMT-UHFFFAOYSA-N
SMILES:O=C1N2C(=NC(C(F)(F)F)=C1)C=CC=C2C
Synonyms:- 4H-Pyrido[1,2-a]pyrimidin-4-one, 6-methyl-2-(trifluoromethyl)-
- 6-Methyl-2-(trifluoromethyl)-4H-pyrido[1,2-a]pyrimidin-4-one
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.