CAS 87592-62-9
:3-Fluorophenyl 4'-trans-butylcyclohexylbenzoate
Description:
3-Fluorophenyl 4'-trans-butylcyclohexylbenzoate, with the CAS number 87592-62-9, is an organic compound characterized by its complex structure, which includes a fluorinated phenyl group, a cyclohexyl moiety, and a benzoate functional group. This compound typically exhibits properties associated with both aromatic and aliphatic systems, contributing to its potential applications in various fields, including pharmaceuticals and materials science. The presence of the fluorine atom can enhance lipophilicity and influence the compound's reactivity and biological activity. Additionally, the trans-butyl group introduces steric effects that may affect the compound's conformation and interactions with biological targets. As a benzoate ester, it may also display characteristics such as moderate solubility in organic solvents and potential stability under certain conditions. Overall, the unique combination of functional groups in 3-Fluorophenyl 4'-trans-butylcyclohexylbenzoate suggests it could be of interest for further research and development in chemical synthesis and application.
Formula:C23H27FO2
InChI:InChI=1/C23H27FO2/c1-2-3-7-17-12-14-18(15-13-17)21-10-4-5-11-22(21)23(25)26-20-9-6-8-19(24)16-20/h4-6,8-11,16-18H,2-3,7,12-15H2,1H3/t17-,18-
SMILES:CCCC[C@H]1CC[C@@H](CC1)c1ccccc1C(=O)Oc1cccc(c1)F
Synonyms:- trans-4-(4-Butylcyclohexyl)benzoic acid 3-fluorophenyl ester
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
