CymitQuimica logo

CAS 87594-59-0

:

4-Aminocarbonyl-3-nitrobenzoic acid

Description:
4-Aminocarbonyl-3-nitrobenzoic acid, with the CAS number 87594-59-0, is an organic compound characterized by the presence of both amino and nitro functional groups attached to a benzoic acid framework. This compound typically exhibits a crystalline solid form and is soluble in polar solvents due to the presence of the carboxylic acid group. The amino group contributes to its basicity, while the nitro group is known for its electron-withdrawing properties, influencing the compound's reactivity and stability. The presence of these functional groups makes it a potential candidate for various applications in pharmaceuticals and organic synthesis. Additionally, the compound may exhibit specific biological activities, which can be explored in medicinal chemistry. Its structural features allow for potential interactions in biological systems, making it of interest for further research in drug development and chemical biology. As with many organic compounds, safety data should be consulted to understand its handling and toxicity profiles.
Formula:C8H6N2O5
InChI:InChI=1/C8H6N2O5/c9-7(11)5-2-1-4(8(12)13)3-6(5)10(14)15/h1-3H,(H2,9,11)(H,12,13)
SMILES:c1cc(c(cc1C(=O)O)N(=O)=O)C(=N)O
Synonyms:
  • 4-Carbamoyl-3-nitrobenzoic acid
  • Benzoic Acid, 4-(Aminocarbonyl)-3-Nitro-
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.