CymitQuimica logo

CAS 87597-21-5

:

Imidazo[1,2-a]pyrazine-2-carboxylic acid, 6,8-dibromo-, ethyl ester

Description:
Imidazo[1,2-a]pyrazine-2-carboxylic acid, 6,8-dibromo-, ethyl ester is a chemical compound characterized by its unique bicyclic structure, which incorporates both imidazole and pyrazine rings. This compound features two bromine substituents at the 6 and 8 positions of the pyrazine ring, enhancing its reactivity and potential biological activity. The presence of the ethyl ester functional group contributes to its solubility and may influence its pharmacokinetic properties. Typically, compounds of this nature are of interest in medicinal chemistry due to their potential as bioactive agents, including antimicrobial or anticancer properties. The molecular structure allows for various interactions with biological targets, making it a candidate for further research in drug development. Additionally, the compound's stability and reactivity can be influenced by the bromine atoms, which may participate in electrophilic substitution reactions. Overall, this compound exemplifies the complexity and diversity of heterocyclic chemistry, with implications for both synthetic and applied chemistry fields.
Formula:C9H7Br2N3O2
InChI:InChI=1S/C9H7Br2N3O2/c1-2-16-9(15)5-3-14-4-6(10)13-7(11)8(14)12-5/h3-4H,2H2,1H3
InChI key:ONYDCYFHPPFRGX-UHFFFAOYSA-N
SMILES:CCOC(=O)C1=CN2C=C(N=C(C2=N1)Br)Br
Found 5 products.