CAS 87597-22-6

Methyl imidazo[1,2-a]pyrazine-2-carboxylate

Description:

Methyl imidazo[1,2-a]pyrazine-2-carboxylate is a heterocyclic organic compound characterized by its imidazole and pyrazine ring structures. It features a carboxylate functional group, which contributes to its reactivity and potential applications in various chemical reactions. The compound is typically a solid at room temperature and is soluble in polar organic solvents, making it useful in synthetic organic chemistry. Its structure allows for potential interactions with biological systems, which may be of interest in medicinal chemistry and drug development. The presence of both nitrogen atoms in the ring systems can influence its electronic properties and reactivity, making it a candidate for further study in the context of pharmacological activity. Additionally, the methyl ester group enhances its stability and solubility, which can be advantageous in various applications, including as a building block in the synthesis of more complex molecules. Overall, Methyl imidazo[1,2-a]pyrazine-2-carboxylate is a versatile compound with potential implications in both research and industry.

Formula: C₈H₇N₃O₂

InChI: InChI=1S/C8H7N3O2/c1-13-8(12)6-5-11-3-2-9-4-7(11)10-6/h2-5H,1H3

InChI key: InChIKey=AUQHCCIYHPAUGQ-UHFFFAOYSA-N

SMILES: C(OC)(=O)C=1N=C2N(C1)C=CN=C2

Synonyms:

• Imidazo[1,2-A]Pyrazine-2-Carboxylic Acid Methyl Ester
• Methyl Imidazo[1,2-A]Pyrazine-2-Carboxylate
• imidazo[1,2-A]pyrazine-2-carboxylate methyl ester

Methyl imidazo[1,2-a]pyrazine-2-carboxylate

CAS: 87597-22-6

Formula: C₈H₇N₃O₂

Molecular weight: 177.1601

Ref: IN-DA008EOJ