CAS 87597-26-0

5-bromoimidazo[1,2-a]pyrazine

Description:

5-Bromoimidazo[1,2-a]pyrazine is a heterocyclic organic compound characterized by its fused imidazole and pyrazine rings, with a bromine substituent at the 5-position of the imidazole ring. This compound typically exhibits a pale yellow to off-white crystalline appearance. It is known for its potential biological activity, making it of interest in medicinal chemistry and drug development. The presence of the bromine atom can influence its reactivity and solubility, often enhancing its lipophilicity. 5-Bromoimidazo[1,2-a]pyrazine may participate in various chemical reactions, including nucleophilic substitutions and coupling reactions, due to the electron-withdrawing nature of the bromine atom. Its structural features contribute to its ability to interact with biological targets, which may include enzymes or receptors, thereby influencing its pharmacological properties. As with many heterocycles, it may also exhibit fluorescence or other photophysical properties, making it useful in various applications, including as a probe in biological studies. Safety and handling precautions should be observed due to its potential biological activity and chemical reactivity.

Formula: C₆H₄BrN₃

InChI: InChI=1/C6H4BrN3/c7-5-3-8-4-6-9-1-2-10(5)6/h1-4H

SMILES: c1cn2c(cncc2n1)Br

Synonyms:

• Imidazo(1,2-a)pyrazine, 5-bromo-

5-Bromoimidazo[1,2-a]pyrazine

CAS: 87597-26-0

Formula: C₆H₄BrN₃

Purity: 95%

Color and Shape: Solid

Molecular weight: 198.0201

Ref: IN-DA004IK8

5-Bromoimidazo[1,2-A]Pyrazine

CAS: 87597-26-0

5-Bromoimidazo[1,2-A]Pyrazine

Purity: ≥95%

Molecular weight: 198.02g/mol

Ref: 54-BUP05287

5-Bromoimidazo[1,2-a]pyrazine

CAS: 87597-26-0

5-Bromoimidazo[1,2-a]pyrazine

Purity: 95%

Molecular weight: 198.02g/mol

Ref: 54-OR903328

5-Bromoimidazo[1,2-A]Pyrazine

CAS: 87597-26-0

5-Bromoimidazo[1,2-a]pyrazine inhibits phosphodiesterase and beta-adrenergic receptors.5-Bromoimidazo[1,2-a]pyrazine shows antibronchospastic activity in vitro.

Formula: C₆H₄BrN₃

Purity: 97.04%

Color and Shape: Solid

Molecular weight: 198.02

Ref: TM-T77641

5-Bromoimidazo[1,2-a]pyrazine

CAS: 87597-26-0

Formula: C₆H₄BrN₃

Purity: 95%

Color and Shape: Solid

Molecular weight: 198.023

Ref: 10-F067620