CymitQuimica logo

CAS 87597-26-0

:

5-bromoimidazo[1,2-a]pyrazine

Description:
5-Bromoimidazo[1,2-a]pyrazine is a heterocyclic organic compound characterized by its fused imidazole and pyrazine rings, with a bromine substituent at the 5-position of the imidazole ring. This compound typically exhibits a pale yellow to off-white crystalline appearance. It is known for its potential biological activity, making it of interest in medicinal chemistry and drug development. The presence of the bromine atom can influence its reactivity and solubility, often enhancing its lipophilicity. 5-Bromoimidazo[1,2-a]pyrazine may participate in various chemical reactions, including nucleophilic substitutions and coupling reactions, due to the electron-withdrawing nature of the bromine atom. Its structural features contribute to its ability to interact with biological targets, which may include enzymes or receptors, thereby influencing its pharmacological properties. As with many heterocycles, it may also exhibit fluorescence or other photophysical properties, making it useful in various applications, including as a probe in biological studies. Safety and handling precautions should be observed due to its potential biological activity and chemical reactivity.
Formula:C6H4BrN3
InChI:InChI=1/C6H4BrN3/c7-5-3-8-4-6-9-1-2-10(5)6/h1-4H
InChI key:VNOIGNRRWFGLBD-UHFFFAOYSA-N
SMILES:c1cn2c(cncc2n1)Br
Synonyms:
  • Imidazo(1,2-a)pyrazine, 5-bromo-
Found 6 products.