CAS 87597-29-3

6,8-Dibromoimidazo[1,2-a]pyrazine-2-carboxamide

Description:

6,8-Dibromoimidazo[1,2-a]pyrazine-2-carboxamide is a heterocyclic compound characterized by its imidazo and pyrazine ring structures, which contribute to its unique chemical properties. This compound features two bromine substituents at the 6 and 8 positions of the imidazo ring, enhancing its reactivity and potential for various applications in medicinal chemistry and material science. The carboxamide functional group at the 2-position adds to its polar character, influencing solubility and interaction with biological targets. Typically, compounds of this nature exhibit interesting biological activities, including antimicrobial and antitumor properties, making them valuable in drug development. The presence of bromine atoms can also facilitate halogen bonding, which is significant in supramolecular chemistry. Additionally, the compound's molecular structure allows for potential interactions with enzymes or receptors, making it a candidate for further research in pharmacology. Overall, 6,8-Dibromoimidazo[1,2-a]pyrazine-2-carboxamide is a versatile compound with promising implications in various scientific fields.

Formula: C₇H₄Br₂N₄O

InChI: InChI=1S/C7H4Br2N4O/c8-4-2-13-1-3(6(10)14)11-7(13)5(9)12-4/h1-2H,(H2,10,14)

InChI key: InChIKey=JFQNGPSIXRRAEW-UHFFFAOYSA-N

SMILES: BrC=1C=2N(C=C(C(N)=O)N2)C=C(Br)N1

Synonyms:

• 6,8-Dibromoimidazo[1,2-a]pyrazine-2-carboxamide
• Imidazo[1,2-a]pyrazine-2-carboxamide, 6,8-dibromo-