CAS 876-32-4
:1-(4-methoxyphenyl)-N-methyl-methanamine hydrochloride
Description:
1-(4-Methoxyphenyl)-N-methyl-methanamine hydrochloride, with the CAS number 876-32-4, is a chemical compound characterized by its amine functional group and aromatic structure. It features a methoxy group (-OCH3) attached to a phenyl ring, which contributes to its hydrophobic properties and potential interactions in biological systems. The presence of the N-methyl group enhances its lipophilicity, allowing for better membrane permeability. As a hydrochloride salt, it is typically more soluble in water compared to its free base form, making it easier to handle in various applications. This compound may exhibit psychoactive properties and has been studied for its potential use in pharmaceuticals, particularly in the context of central nervous system activity. Its structural characteristics suggest it could interact with neurotransmitter systems, although specific biological effects would depend on further empirical studies. Safety and handling precautions should be observed, as with all chemical substances, due to potential toxicity or reactivity.
Formula:C9H14ClNO
InChI:InChI=1/C9H13NO.ClH/c1-10-7-8-3-5-9(11-2)6-4-8;/h3-6,10H,7H2,1-2H3;1H
SMILES:CNCc1ccc(cc1)OC.Cl
Synonyms:- 1-(4-Methoxyphenyl)-N-methylmethanamine hydrochloride (1:1)
- benzenemethanamine, 4-methoxy-N-methyl-, hydrochloride (1:1)
- 4-Methoxy-N-Methylbenzylamine Hydrochloride
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 4 products.
4-Methoxy-n-methylbenzylamine, HCl
CAS:Formula:C9H14ClNOPurity:97%Color and Shape:SolidMolecular weight:187.66664-Methoxy-N-methylbenzylamine hydrochloride
CAS:<p>4-Methoxy-N-methylbenzylamine hydrochloride</p>Purity:98%Color and Shape:White SolidMolecular weight:187.67g/mol4-Methoxy-N-methylbenzylamine hydrochloride
CAS:Formula:C9H14ClNOPurity:97%Color and Shape:SolidMolecular weight:187.674-Methoxy-N-methylbenzylamine hydrochloride
CAS:<p>Please enquire for more information about 4-Methoxy-N-methylbenzylamine hydrochloride including the price, delivery time and more detailed product information at the technical inquiry form on this page</p>Formula:C9H14NOClPurity:Min. 95%Molecular weight:187.67 g/mol



