CAS 876-53-9
:1,3-dibromoadamantane
Description:
1,3-Dibromoadamantane is a halogenated derivative of adamantane, characterized by the presence of two bromine atoms attached to the first and third carbon atoms of the adamantane structure. This compound is a colorless to pale yellow solid at room temperature and exhibits a crystalline structure. It is relatively stable under standard conditions but can undergo reactions typical of alkyl halides, such as nucleophilic substitution. The presence of bromine atoms enhances its reactivity compared to non-halogenated adamantane derivatives. 1,3-Dibromoadamantane is soluble in organic solvents like dichloromethane and chloroform but has limited solubility in water due to its hydrophobic adamantane core. Its unique structure and reactivity make it of interest in organic synthesis and materials science, particularly in the development of new compounds with potential applications in pharmaceuticals and polymer chemistry. Safety precautions should be taken when handling this compound, as brominated compounds can pose health risks.
Formula:C10H14Br2
InChI:InChI=1/C10H14Br2/c11-9-2-7-1-8(4-9)5-10(12,3-7)6-9/h7-8H,1-6H2
SMILES:C1C2CC3(CC1CC(C2)(C3)Br)Br
Synonyms:- Dibromoadamantane,97%
- Dibromoadamantane
- 1,3-Dibromotricyclo[3.3.1.1~3,7~]Decane
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 11 products.
1,3-Dibromoadamantane (purified by sublimation)
CAS:Formula:C10H14Br2Purity:>99.0%(GC)Color and Shape:White to Almost white powder to crystalMolecular weight:294.031,3-Dibromoadamantane
CAS:Formula:C10H14Br2Purity:>97.0%(GC)Color and Shape:White to Orange to Green powder to crystalMolecular weight:294.031,3-Dibromoadamantane
CAS:Controlled Product<p>Applications 1,3-Dibromoadamantane (cas# 876-53-9) is a compound useful in organic synthesis.<br></p>Formula:C10H14Br2Color and Shape:NeatMolecular weight:294.031,3-Dibromoadamantane
CAS:<p>1,3-Dibromoadamantane is an organic compound that belongs to the group of organobromides. It has a chemical structure with three bromine atoms and one carbon atom, which are bonded to each other in a triangle shape. 1,3-Dibromoadamantane is soluble in solvents such as water and methanol. The reaction yield of 1,3-dibromoadamantane is 100% when it reacts with hydrochloric acid as the catalyst under optimal conditions. The reaction also occurs at a high temperature (100 degrees Celsius) and releases energy efficiently. 1,3-Dibromoadamantane can be used as a substrate molecule for the Suzuki coupling reaction.<br>The coordination chemistry of 1,3-dibromoadamantane involves the formation of a square planar complex with copper ions and ammonia molecules to form copper(I) ammine complexes, which are then able to bind</p>Formula:C10H14Br2Purity:Min. 95%Color and Shape:PowderMolecular weight:294.03 g/mol
