CAS 876-54-0
:Tricyclo[3.3.1.1<sup>3,7</sup>]decan-1-amine, 3-bromo-, hydrobromide (1:1)
Description:
Tricyclo[3.3.1.1^3,7]decan-1-amine, 3-bromo-, hydrobromide (1:1) is a chemical compound characterized by its unique tricyclic structure, which consists of three interconnected cycloalkane rings. The presence of a bromine atom at the 3-position of the tricyclic framework contributes to its reactivity and potential applications in organic synthesis. As a hydrobromide salt, it is typically encountered in a crystalline form, which enhances its stability and solubility in polar solvents. This compound is of interest in medicinal chemistry and materials science due to its structural complexity and the potential for diverse functionalization. Its amine group can participate in various chemical reactions, making it a versatile building block in the synthesis of more complex molecules. Additionally, the hydrobromide form indicates that it can act as a source of bromide ions in reactions. Safety data should be consulted for handling, as halogenated compounds can pose health risks. Overall, this compound exemplifies the intricate interplay between structure and reactivity in organic chemistry.
Formula:C10H16BrN·BrH
InChI:InChI=1S/C10H16BrN.BrH/c11-9-2-7-1-8(3-9)5-10(12,4-7)6-9;/h7-8H,1-6,12H2;1H
InChI key:InChIKey=OFFXLPNFRNVUEN-UHFFFAOYSA-N
SMILES:BrC12CC3(N)CC(C1)CC(C2)C3.Br
Synonyms:- Tricyclo[3.3.1.13,7]decan-1-amine, 3-bromo-, hydrobromide (1:1)
- Tricyclo[3.3.1.13,7]decan-1-amine, 3-bromo-, hydrobromide
- 1-Adamantanamine, 3-bromo-, hydrobromide
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 2 products.
