CAS 876-87-9
:Quinolinium, 1,2-dimethyl-, iodide (1:1)
Description:
Quinolinium, 1,2-dimethyl-, iodide (1:1) is a quaternary ammonium compound characterized by its structure, which includes a quinolinium ring and two methyl groups attached to the nitrogen atom. This compound typically appears as a solid or crystalline substance and is known for its solubility in polar solvents, such as water and alcohols, due to the presence of the iodide ion. Quinolinium derivatives often exhibit interesting biological activities, including antimicrobial and antitumor properties, making them of interest in medicinal chemistry. The iodide ion contributes to the compound's stability and can influence its reactivity and interaction with biological systems. Additionally, the presence of the dimethyl groups can affect the compound's lipophilicity and overall pharmacokinetic profile. As with many quaternary ammonium compounds, safety precautions should be taken when handling this substance, as it may pose health risks if ingested or inhaled. Overall, quinolinium, 1,2-dimethyl-, iodide (1:1) is a notable compound in the field of organic chemistry and pharmacology.
Formula:C11H12N·I
InChI:InChI=1S/C11H12N.HI/c1-9-7-8-10-5-3-4-6-11(10)12(9)2;/h3-8H,1-2H3;1H/q+1;/p-1
InChI key:InChIKey=XXCFMHCLWHXDAV-UHFFFAOYSA-M
SMILES:C[N+]=1C2=C(C=CC1C)C=CC=C2.[I-]
Synonyms:- Quinolinium, 1,2-dimethyl-, iodide (1:1)
- 1-Methylquinaldinium iodide
- Quinolinium, 1,2-dimethyl-, iodide
- Quinaldinium, 1-methyl-, iodide
- 1,2-Dimethylquinolinium iodide
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.