CAS 87600-98-4
:4,6-dichloropyrimidine-5-carboxylic acid
Description:
4,6-Dichloropyrimidine-5-carboxylic acid is a heterocyclic organic compound characterized by a pyrimidine ring substituted with two chlorine atoms and a carboxylic acid group. The presence of chlorine atoms at the 4 and 6 positions of the pyrimidine ring contributes to its reactivity and potential applications in various chemical reactions. The carboxylic acid functional group at the 5 position enhances its acidity and solubility in polar solvents, making it useful in synthetic organic chemistry. This compound is often utilized as an intermediate in the synthesis of pharmaceuticals, agrochemicals, and other biologically active molecules. Its structural features allow for potential interactions with biological targets, making it of interest in medicinal chemistry. Additionally, the compound's stability and reactivity can be influenced by the electronic effects of the chlorine substituents, which can affect its behavior in chemical reactions. Overall, 4,6-dichloropyrimidine-5-carboxylic acid is a versatile compound with significant implications in chemical synthesis and research.
Formula:C5H2Cl2N2O2
InChI:InChI=1/C5H2Cl2N2O2/c6-3-2(5(10)11)4(7)9-1-8-3/h1H,(H,10,11)
SMILES:c1nc(c(c(Cl)n1)C(=O)O)Cl
Synonyms:- 5-Pyrimidinecarboxylic Acid, 4,6-Dichloro-
- Acide 4,6-dichloropyrimidine-5-carboxylique
- 4,6-Dichloro-5-pyrimidinecarboxylic acid
- 5-Carboxy-4,6-dichloropyrimidine
- 4,6-Dichloro-pyriMidine-5-carboxylic acid 98%
- 4,6-dichloropyrimidine-5-carboxylic acid ISO 9001:2015 REACH
- 4,6-Dichloropyrimidine-5-Carboxylic Acid(WX614308)
- 4,6-DichloropyriMidin-5-carboxylic acid
- 5-Carboxy-4,6-dichloropyrimidine, 5-Carboxy-4,6-dichloro-1,3-diazine
- 4,6-dichloro-5-pyrimidinecarboxylic
- 4,6-dichloropyrimidine-5-carboxylic acid
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 4 products.
4,6-Dichloro-5-pyrimidinecarboxylic acid
CAS:Formula:C5H2Cl2N2O2Purity:95%Color and Shape:SolidMolecular weight:192.98764,6-Dichloropyrimidine-5-carboxylic acid
CAS:Formula:C5H2Cl2N2O2Purity:≥ 98.0%Color and Shape:White to off-white powderMolecular weight:192.994,6-Dichloropyrimidine-5-carboxylic acid
CAS:<p>4,6-Dichloropyrimidine-5-carboxylic acid</p>Purity:97%Color and Shape:SolidMolecular weight:192.99g/mol4,6-Dichloropyrimidine-5-carboxylic acid
CAS:Formula:C5H2Cl2N2O2Purity:95%Color and Shape:SolidMolecular weight:192.98



