CAS 87603-45-0

2-chloro-N-(2-methylpropyl)propanamide

Description:

2-Chloro-N-(2-methylpropyl)propanamide is an organic compound characterized by its amide functional group, which is derived from propanoic acid. The presence of a chlorine atom at the second carbon position and a branched alkyl group (2-methylpropyl) attached to the nitrogen atom contributes to its unique chemical properties. This compound is typically a colorless to pale yellow liquid or solid, depending on its purity and temperature. It is soluble in organic solvents and exhibits moderate stability under standard conditions. The chlorine substituent can influence its reactivity, making it a potential candidate for various chemical reactions, including nucleophilic substitutions. Additionally, the branched alkyl group may affect its steric hindrance and overall reactivity. As with many amides, it may exhibit hydrogen bonding capabilities, influencing its boiling point and solubility in polar solvents. Safety precautions should be taken when handling this compound, as it may pose health risks, including irritation or toxicity, depending on exposure levels.

Formula: C₇H₁₄ClNO

InChI: InChI=1/C7H14ClNO/c1-5(2)4-9-7(10)6(3)8/h5-6H,4H2,1-3H3,(H,9,10)

SMILES: CC(C)CN=C(C(C)Cl)O

Synonyms:

• 2-Chloro-N-isobutylpropanamide
• Propanamide, 2-chloro-N-(2-methylpropyl)-