CAS 876144-87-5

1-(2-Chloro-4-pyrimidinyl)-4-piperidinemethanamine

Description:

1-(2-Chloro-4-pyrimidinyl)-4-piperidinemethanamine, identified by its CAS number 876144-87-5, is a chemical compound characterized by its unique structure that includes a pyrimidine ring and a piperidine moiety. This compound typically exhibits properties associated with amines, such as basicity due to the presence of the amine functional group. The chloro substituent on the pyrimidine ring can influence its reactivity and interaction with biological targets, making it of interest in medicinal chemistry. The compound may exhibit moderate to high solubility in polar solvents, depending on the specific conditions and the presence of functional groups. Its potential applications could include roles in drug development, particularly in targeting specific receptors or enzymes due to the structural features that allow for molecular recognition. As with many chemical substances, safety data and handling precautions should be considered, as the presence of chlorine and amine groups may pose certain hazards. Overall, this compound represents a class of molecules that can be explored for various therapeutic applications.

Formula: C₁₀H₁₅ClN₄

InChI: InChI=1S/C10H15ClN4/c11-10-13-4-1-9(14-10)15-5-2-8(7-12)3-6-15/h1,4,8H,2-3,5-7,12H2

InChI key: InChIKey=VFMAOEDODJWCHQ-UHFFFAOYSA-N

SMILES: ClC=1N=C(C=CN1)N2CCC(CN)CC2

Synonyms:

• [1-(2-Chloropyrimidin-4-yl)piperidin-4-yl]methanamine
• 4-Piperidinemethanamine, 1-(2-chloro-4-pyrimidinyl)-
• 1-(2-Chloro-4-pyrimidinyl)-4-piperidinemethanamine