CAS 87617-29-6

2-Amino-5-isopropylbenzotrifluoride

Description:

2-Amino-5-isopropylbenzotrifluoride, with the CAS number 87617-29-6, is an organic compound characterized by the presence of an amino group and a trifluoromethyl group attached to a benzene ring that also contains an isopropyl substituent. This compound typically exhibits properties associated with aromatic amines, such as moderate solubility in organic solvents and potential reactivity due to the amino group, which can participate in various chemical reactions, including nucleophilic substitutions. The trifluoromethyl group enhances the compound's lipophilicity and can influence its electronic properties, making it of interest in various applications, including pharmaceuticals and agrochemicals. Additionally, the presence of the isopropyl group contributes to steric hindrance, which may affect the compound's reactivity and interaction with biological systems. Safety data should be consulted, as compounds with trifluoromethyl groups can exhibit unique toxicological profiles. Overall, 2-Amino-5-isopropylbenzotrifluoride is a compound of interest in synthetic organic chemistry and material science.

Formula: C₁₀H₁₂F₃N

InChI: InChI=1/C10H12F3N/c1-6(2)7-3-4-9(14)8(5-7)10(11,12)13/h3-6H,14H2,1-2H3

SMILES: CC(C)c1ccc(c(c1)C(F)(F)F)N

Synonyms:

• 4-Isopropyl-2-(trifluoromethyl)aniline
• 4-(1-Methylethyl)-2-(Trifluoromethyl)Aniline

2-Amino-5-isopropylbenzotrifluoride

CAS: 87617-29-6

Formula: C₁₀H₁₂F₃N

Molecular weight: 203.2042

Ref: IN-DA003LLB

4-Isopropyl-2-(trifluoromethyl)aniline

CAS: 87617-29-6

4-Isopropyl-2-(trifluoromethyl)aniline

Purity: ≥95%

Color and Shape: Pale Yellow Liquid

Molecular weight: 203.20g/mol

Ref: 54-PC0396

4-iso-Propyl-2-(trifluoromethyl)aniline

CAS: 87617-29-6

Formula: C₁₀H₁₂F₃N

Color and Shape: Liquid

Molecular weight: 203.208

Ref: 10-F005825