CAS 87620-09-5
:neurotensin fragment 1-6
Description:
Neurotensin fragment 1-6, with the CAS number 87620-09-5, is a peptide derived from neurotensin, a neuropeptide involved in various physiological processes, including pain modulation, regulation of body temperature, and influence on the endocrine system. This specific fragment consists of the first six amino acids of the neurotensin molecule, which contributes to its biological activity. Characteristically, it exhibits a relatively small molecular size and is soluble in aqueous solutions, making it suitable for various biochemical assays. Neurotensin and its fragments interact with specific receptors in the nervous system, influencing neurotransmission and potentially playing a role in neuropsychiatric disorders. The stability of this peptide can be affected by factors such as pH and temperature, and it may be subject to enzymatic degradation. Overall, neurotensin fragment 1-6 serves as a valuable tool in research related to neurobiology and pharmacology, providing insights into the mechanisms of neuropeptide action and potential therapeutic applications.
Formula:C35H52N8O12
InChI:InChI=1/C35H52N8O12/c1-18(2)15-24(41-30(49)21-10-12-28(46)38-21)32(51)42-25(16-19-6-8-20(44)9-7-19)33(52)39-22(11-13-29(47)48)31(50)43-26(17-27(37)45)34(53)40-23(35(54)55)5-3-4-14-36/h6-9,18,21-26,44H,3-5,10-17,36H2,1-2H3,(H2,37,45)(H,38,46)(H,39,52)(H,40,53)(H,41,49)(H,42,51)(H,43,50)(H,47,48)(H,54,55)/t21-,22-,23-,24-,25-,26-/m0/s1
SMILES:CC(C)C[C@@H](C(=N[C@@H](Cc1ccc(cc1)O)C(=N[C@@H](CCC(=O)O)C(=N[C@@H](CC(=N)O)C(=N[C@@H](CCCCN)C(=O)O)O)O)O)O)N=C([C@@H]1CCC(=N1)O)O
Synonyms:- Neurotensin (1-6)
- Pyr-Leu-Tyr-Glu-Asn-Lys-OH
- 5-oxo-L-prolyl-L-leucyl-L-tyrosyl-L-alpha-glutamyl-L-asparaginyl-L-lysine
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 2 products.
Neurotensin (1-6)
CAS:Neurotensin (1-6) affects dopamine release from striatum.Formula:C35H52N8O12Color and Shape:SolidMolecular weight:776.83Neurotensin (1-6) trifluoroacetate salt Pyr-Leu-Tyr-Glu-Asn-Lys-OH trifluoroacetate salt
CAS:<p>Please enquire for more information about Neurotensin (1-6) trifluoroacetate salt Pyr-Leu-Tyr-Glu-Asn-Lys-OH trifluoroacetate salt including the price, delivery time and more detailed product information at the technical inquiry form on this page</p>Formula:C35H52N8O12Purity:Min. 95%Molecular weight:776.83 g/mol

