CAS 87628-52-2

3-(4-chlorophenyl)-4,5,6,7-tetrahydro-1H-pyrazolo[4,3-c]pyridine hydrochloride

Description:

3-(4-Chlorophenyl)-4,5,6,7-tetrahydro-1H-pyrazolo[4,3-c]pyridine hydrochloride is a chemical compound characterized by its complex bicyclic structure, which includes a pyrazolo[4,3-c]pyridine core. This compound features a 4-chlorophenyl substituent, contributing to its potential biological activity. As a hydrochloride salt, it is typically more soluble in water compared to its free base form, enhancing its utility in pharmaceutical applications. The presence of the tetrahydro moiety indicates that it has a saturated ring system, which may influence its pharmacokinetic properties. This compound is of interest in medicinal chemistry, particularly for its potential effects on the central nervous system or as a therapeutic agent. Its specific interactions and mechanisms of action would depend on its binding affinity to various biological targets. Safety and handling precautions are essential, as with any chemical substance, particularly in laboratory settings.

Formula: C₁₂H₁₃Cl₂N₃

InChI: InChI=1/C12H12ClN3.ClH/c13-9-3-1-8(2-4-9)12-10-7-14-6-5-11(10)15-16-12;/h1-4,14H,5-7H2,(H,15,16);1H

SMILES: c1cc(ccc1c1c2CNCCc2[nH]n1)Cl.Cl

3-(4-chlorophenyl)-1H,4H,5H,6H,7H-pyrazolo[4,3-c]pyridine hydrochloride

CAS: 87628-52-2

Formula: C₁₂H₁₃Cl₂N₃

Molecular weight: 270.1577

Ref: IN-DA004P1W