CAS 876294-74-5

1-(3-Methoxypropyl)-2,5-dimethyl-1H-pyrrole-3-carboxylic acid

Description:

1-(3-Methoxypropyl)-2,5-dimethyl-1H-pyrrole-3-carboxylic acid is a chemical compound characterized by its pyrrole ring structure, which is a five-membered aromatic heterocycle containing nitrogen. This compound features a carboxylic acid functional group, contributing to its acidity and potential reactivity. The presence of the methoxypropyl group enhances its solubility in organic solvents and may influence its biological activity. The two methyl groups on the pyrrole ring can affect the compound's steric and electronic properties, potentially impacting its interactions with biological targets. This compound may exhibit interesting pharmacological properties, making it a subject of interest in medicinal chemistry. Its molecular structure suggests potential applications in drug development, particularly in areas requiring compounds with specific biological activities. As with many organic compounds, its stability, reactivity, and solubility will depend on environmental conditions such as pH and temperature. Further studies would be necessary to fully elucidate its properties and potential applications in various fields, including pharmaceuticals and agrochemicals.

Formula: C₁₁H₁₇NO₃

InChI: InChI=1S/C11H17NO3/c1-8-7-10(11(13)14)9(2)12(8)5-4-6-15-3/h7H,4-6H2,1-3H3,(H,13,14)

InChI key: InChIKey=RVAKZEVLRPWVPQ-UHFFFAOYSA-N

SMILES: C(CCOC)N1C(C)=C(C(O)=O)C=C1C

Synonyms:

• 1-(3-Methoxypropyl)-2,5-dimethyl-1H-pyrrole-3-carboxylic acid
• 1H-Pyrrole-3-carboxylic acid, 1-(3-methoxypropyl)-2,5-dimethyl-
• 1-(3-Methoxypropyl)-2,5-dimethylpyrrole-3-carboxylic acid